C22H33N3O — CID 143311625
(2S)-4-benzyl-N-[(1R)-1,2,3,4,5,6-hexahydronaphthalen-1-yl]piperazine-2-carboxamide;molecular hydrogen (PubChem CID 143311625) has the molecular formula C22H33N3O and a molecular weight of 355.53 g/mol. Its IUPAC name is (2S)-4-benzyl-N-[(1R)-1,2,3,4,5,6-hexahydronaphthalen-1-yl]piperazine-2-carboxamide;molecular hydrogen.
| Compound Name | (2S)-4-benzyl-N-[(1R)-1,2,3,4,5,6-hexahydronaphthalen-1-yl]piperazine-2-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 143311625 |
| Molecular Formula | C22H33N3O |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | (2S)-4-benzyl-N-[(1R)-1,2,3,4,5,6-hexahydronaphthalen-1-yl]piperazine-2-carboxamide;molecular hydrogen |
| SMILES | O=C(N[C@@H]1CCCC2=C1C=CCC2)[C@@H]1CN(Cc2ccccc2)CCN1.[H][H].[H][H] |
| InChI | InChI=1S/C22H29N3O.2H2/c26-22(24-20-12-6-10-18-9-4-5-11-19(18)20)21-16-25(14-13-23-21)15-17-7-2-1-3-8-17;;/h1-3,5,7-8,11,20-21,23H,4,6,9-10,12-16H2,(H,24,26);2*1H/t20-,21+;;/m1../s1 |
| InChIKey | VCEWSKOQFLNCBC-KMDCRFISSA-N |
| XLogP | 3.27 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |