C36H42N2O4Si — CID 70975721
4-[1-[tert-butyl(dimethyl)silyl]oxy-4-phenylbutyl]-5-[4-[4-(1-formylcyclopropyl)phenyl]phenyl]-1,2-oxazole-3-carboxamide (PubChem CID 70975721) has the molecular formula C36H42N2O4Si and a molecular weight of 594.83 g/mol. Its IUPAC name is 4-[1-[tert-butyl(dimethyl)silyl]oxy-4-phenylbutyl]-5-[4-[4-(1-formylcyclopropyl)phenyl]phenyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 4-[1-[tert-butyl(dimethyl)silyl]oxy-4-phenylbutyl]-5-[4-[4-(1-formylcyclopropyl)phenyl]phenyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 70975721 |
| Molecular Formula | C36H42N2O4Si |
| Molecular Weight | 594.83 g/mol |
| Exact Mass | 594.29 |
| IUPAC Name | 4-[1-[tert-butyl(dimethyl)silyl]oxy-4-phenylbutyl]-5-[4-[4-(1-formylcyclopropyl)phenyl]phenyl]-1,2-oxazole-3-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCCc1ccccc1)c1c(C(N)=O)noc1-c1ccc(-c2ccc(C3(C=O)CC3)cc2)cc1 |
| InChI | InChI=1S/C36H42N2O4Si/c1-35(2,3)43(4,5)42-30(13-9-12-25-10-7-6-8-11-25)31-32(34(37)40)38-41-33(31)28-16-14-26(15-17-28)27-18-20-29(21-19-27)36(24-39)22-23-36/h6-8,10-11,14-21,24,30H,9,12-13,22-23H2,1-5H3,(H2,37,40) |
| InChIKey | SNGHFSRSMPMHKI-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.83 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|