C24H23N5O — CID 70977064
2-[3-[1-[[2-methyl-6-(1-methylindol-6-yl)pyrimidin-4-yl]amino]ethyl]phenoxy]acetonitrile (PubChem CID 70977064) has the molecular formula C24H23N5O and a molecular weight of 397.48 g/mol. Its IUPAC name is 2-[3-[1-[[2-methyl-6-(1-methylindol-6-yl)pyrimidin-4-yl]amino]ethyl]phenoxy]acetonitrile.
| Compound Name | 2-[3-[1-[[2-methyl-6-(1-methylindol-6-yl)pyrimidin-4-yl]amino]ethyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 70977064 |
| Molecular Formula | C24H23N5O |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 2-[3-[1-[[2-methyl-6-(1-methylindol-6-yl)pyrimidin-4-yl]amino]ethyl]phenoxy]acetonitrile |
| SMILES | Cc1nc(NC(C)c2cccc(OCC#N)c2)cc(-c2ccc3ccn(C)c3c2)n1 |
| InChI | InChI=1S/C24H23N5O/c1-16(19-5-4-6-21(13-19)30-12-10-25)26-24-15-22(27-17(2)28-24)20-8-7-18-9-11-29(3)23(18)14-20/h4-9,11,13-16H,12H2,1-3H3,(H,26,27,28) |
| InChIKey | UUDLTYHJTOXXNX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |