C21H15F3N2O3S — CID 70978272
(E)-3-pyridin-3-yl-N-[4-[3-(trifluoromethyl)phenyl]sulfonylphenyl]prop-2-enamide (PubChem CID 70978272) has the molecular formula C21H15F3N2O3S and a molecular weight of 432.42 g/mol. Its IUPAC name is (E)-3-pyridin-3-yl-N-[4-[3-(trifluoromethyl)phenyl]sulfonylphenyl]prop-2-enamide.
| Compound Name | (E)-3-pyridin-3-yl-N-[4-[3-(trifluoromethyl)phenyl]sulfonylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 70978272 |
| Molecular Formula | C21H15F3N2O3S |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | (E)-3-pyridin-3-yl-N-[4-[3-(trifluoromethyl)phenyl]sulfonylphenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccnc1)Nc1ccc(S(=O)(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H15F3N2O3S/c22-21(23,24)16-4-1-5-19(13-16)30(28,29)18-9-7-17(8-10-18)26-20(27)11-6-15-3-2-12-25-14-15/h1-14H,(H,26,27)/b11-6+ |
| InChIKey | XAAMIOKIQMXZMA-IZZDOVSWSA-N |
| XLogP | 4.59 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|