C23H22N2O4S — CID 70978689
(E)-N-[4-(4-methoxy-3,5-dimethylphenyl)sulfonylphenyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 70978689) has the molecular formula C23H22N2O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is (E)-N-[4-(4-methoxy-3,5-dimethylphenyl)sulfonylphenyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[4-(4-methoxy-3,5-dimethylphenyl)sulfonylphenyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 70978689 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (E)-N-[4-(4-methoxy-3,5-dimethylphenyl)sulfonylphenyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | COc1c(C)cc(S(=O)(=O)c2ccc(NC(=O)/C=C/c3cccnc3)cc2)cc1C |
| InChI | InChI=1S/C23H22N2O4S/c1-16-13-21(14-17(2)23(16)29-3)30(27,28)20-9-7-19(8-10-20)25-22(26)11-6-18-5-4-12-24-15-18/h4-15H,1-3H3,(H,25,26)/b11-6+ |
| InChIKey | KBNPIBHWQQCDDN-IZZDOVSWSA-N |
| XLogP | 4.19 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|