C28H27N5O4S — CID 70983409
benzyl 3-[10-(4-methylphenyl)sulfonyl-4,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl]piperidine-1-carboxylate (PubChem CID 70983409) has the molecular formula C28H27N5O4S and a molecular weight of 529.62 g/mol. Its IUPAC name is benzyl 3-[10-(4-methylphenyl)sulfonyl-4,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl]piperidine-1-carboxylate.
| Compound Name | benzyl 3-[10-(4-methylphenyl)sulfonyl-4,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70983409 |
| Molecular Formula | C28H27N5O4S |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | benzyl 3-[10-(4-methylphenyl)sulfonyl-4,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2ncn2cnc(C4CCCN(C(=O)OCc5ccccc5)C4)c32)cc1 |
| InChI | InChI=1S/C28H27N5O4S/c1-20-9-11-23(12-10-20)38(35,36)33-15-13-24-26-25(29-18-32(26)19-30-27(24)33)22-8-5-14-31(16-22)28(34)37-17-21-6-3-2-4-7-21/h2-4,6-7,9-13,15,18-19,22H,5,8,14,16-17H2,1H3 |
| InChIKey | OUXBNYSNNOUVEW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 98.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |