C22H25N5O2 — CID 123586009
benzyl 3-(11-methyl-4,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-3-yl)piperidine-1-carboxylate (PubChem CID 123586009) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is benzyl 3-(11-methyl-4,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-3-yl)piperidine-1-carboxylate.
| Compound Name | benzyl 3-(11-methyl-4,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123586009 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | benzyl 3-(11-methyl-4,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-3-yl)piperidine-1-carboxylate |
| SMILES | CC1Cc2c(ncn3cnc(C4CCCN(C(=O)OCc5ccccc5)C4)c23)N1 |
| InChI | InChI=1S/C22H25N5O2/c1-15-10-18-20-19(23-13-27(20)14-24-21(18)25-15)17-8-5-9-26(11-17)22(28)29-12-16-6-3-2-4-7-16/h2-4,6-7,13-15,17,25H,5,8-12H2,1H3 |
| InChIKey | KTHNXQAFGDVMCH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |