C23H26N4O3S — CID 7098904
[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-1-phenylpentylideneamino]carbamimidothioate (PubChem CID 7098904) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is [(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-1-phenylpentylideneamino]carbamimidothioate.
| Compound Name | [(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-1-phenylpentylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 7098904 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | [(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-1-phenylpentylideneamino]carbamimidothioate |
| SMILES | CCCC/C(=N/N=C(N)S[C@@H]1CC(=O)N(c2ccc(OC)cc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C23H26N4O3S/c1-3-4-10-19(16-8-6-5-7-9-16)25-26-23(24)31-20-15-21(28)27(22(20)29)17-11-13-18(30-2)14-12-17/h5-9,11-14,20H,3-4,10,15H2,1-2H3,(H2,24,26)/b25-19-/t20-/m1/s1 |
| InChIKey | ADSLEKXDYZQLKR-TTWQBBKJSA-N |
| XLogP | 3.97 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|