C28H39N5O4 — CID 70996687
[(2S,5R)-5-[2-[[4-ethoxy-3-(3-piperazin-1-ylpropoxy)phenyl]methylamino]benzimidazol-1-yl]oxolan-2-yl]methanol (PubChem CID 70996687) has the molecular formula C28H39N5O4 and a molecular weight of 509.65 g/mol. Its IUPAC name is [(2S,5R)-5-[2-[[4-ethoxy-3-(3-piperazin-1-ylpropoxy)phenyl]methylamino]benzimidazol-1-yl]oxolan-2-yl]methanol.
| Compound Name | [(2S,5R)-5-[2-[[4-ethoxy-3-(3-piperazin-1-ylpropoxy)phenyl]methylamino]benzimidazol-1-yl]oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 70996687 |
| Molecular Formula | C28H39N5O4 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | [(2S,5R)-5-[2-[[4-ethoxy-3-(3-piperazin-1-ylpropoxy)phenyl]methylamino]benzimidazol-1-yl]oxolan-2-yl]methanol |
| SMILES | CCOc1ccc(CNc2nc3ccccc3n2[C@H]2CC[C@@H](CO)O2)cc1OCCCN1CCNCC1 |
| InChI | InChI=1S/C28H39N5O4/c1-2-35-25-10-8-21(18-26(25)36-17-5-14-32-15-12-29-13-16-32)19-30-28-31-23-6-3-4-7-24(23)33(28)27-11-9-22(20-34)37-27/h3-4,6-8,10,18,22,27,29,34H,2,5,9,11-17,19-20H2,1H3,(H,30,31)/t22-,27+/m0/s1 |
| InChIKey | JWNZSCRGFLFZRD-WXVAWEFUSA-N |
| XLogP | 3.39 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|