C30H37N5O6S — CID 11989151
1-[3-[[2-[[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]benzimidazol-2-yl]amino]methyl]-1-benzothiophen-6-yl]oxy]propyl]piperidine-4-carboxamide (PubChem CID 11989151) has the molecular formula C30H37N5O6S and a molecular weight of 595.72 g/mol. Its IUPAC name is 1-[3-[[2-[[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]benzimidazol-2-yl]amino]methyl]-1-benzothiophen-6-yl]oxy]propyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[[2-[[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]benzimidazol-2-yl]amino]methyl]-1-benzothiophen-6-yl]oxy]propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 11989151 |
| Molecular Formula | C30H37N5O6S |
| Molecular Weight | 595.72 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | 1-[3-[[2-[[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]benzimidazol-2-yl]amino]methyl]-1-benzothiophen-6-yl]oxy]propyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(CCCOc2ccc3cc(CNc4nc5ccccc5n4[C@@H]4O[C@H](CO)[C@@H](O)[C@H]4O)sc3c2)CC1 |
| InChI | InChI=1S/C30H37N5O6S/c31-28(39)18-8-11-34(12-9-18)10-3-13-40-20-7-6-19-14-21(42-25(19)15-20)16-32-30-33-22-4-1-2-5-23(22)35(30)29-27(38)26(37)24(17-36)41-29/h1-2,4-7,14-15,18,24,26-27,29,36-38H,3,8-13,16-17H2,(H2,31,39)(H,32,33)/t24-,26-,27-,29-/m1/s1 |
| InChIKey | PUMDYDYNCJHBSY-UNXBZVTQSA-N |
| XLogP | 2.44 |
| TPSA | 155.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.72 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|