C32H40N8O6 — CID 67541638
1-[3-[5-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]-methylamino]-2-phenylphenoxy]propyl]piperidine-4-carboxamide (PubChem CID 67541638) has the molecular formula C32H40N8O6 and a molecular weight of 632.72 g/mol. Its IUPAC name is 1-[3-[5-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]-methylamino]-2-phenylphenoxy]propyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[5-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]-methylamino]-2-phenylphenoxy]propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 67541638 |
| Molecular Formula | C32H40N8O6 |
| Molecular Weight | 632.72 g/mol |
| Exact Mass | 632.31 |
| IUPAC Name | 1-[3-[5-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]-methylamino]-2-phenylphenoxy]propyl]piperidine-4-carboxamide |
| SMILES | CN(c1ccc(-c2ccccc2)c(OCCCN2CCC(C(N)=O)CC2)c1)c1nc2c(N)ncnc2n1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C32H40N8O6/c1-38(32-37-25-28(33)35-18-36-30(25)40(32)31-27(43)26(42)24(17-41)46-31)21-8-9-22(19-6-3-2-4-7-19)23(16-21)45-15-5-12-39-13-10-20(11-14-39)29(34)44/h2-4,6-9,16,18,20,24,26-27,31,41-43H,5,10-15,17H2,1H3,(H2,34,44)(H2,33,35,36)/t24-,26-,27-,31-/m1/s1 |
| InChIKey | LFLKXPXBQYTFLJ-YUGARCTCSA-N |
| XLogP | 1.42 |
| TPSA | 198.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.72 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|