C26H28N6O7 — CID 67457802
methyl 2-[2-[4-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]-methylamino]phenyl]phenoxy]acetate (PubChem CID 67457802) has the molecular formula C26H28N6O7 and a molecular weight of 536.55 g/mol. Its IUPAC name is methyl 2-[2-[4-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]-methylamino]phenyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-[4-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]-methylamino]phenyl]phenoxy]acetate |
|---|---|
| PubChem CID | 67457802 |
| Molecular Formula | C26H28N6O7 |
| Molecular Weight | 536.55 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | methyl 2-[2-[4-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]-methylamino]phenyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccccc1-c1ccc(N(C)c2nc3c(N)ncnc3n2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C26H28N6O7/c1-31(15-9-7-14(8-10-15)16-5-3-4-6-17(16)38-12-19(34)37-2)26-30-20-23(27)28-13-29-24(20)32(26)25-22(36)21(35)18(11-33)39-25/h3-10,13,18,21-22,25,33,35-36H,11-12H2,1-2H3,(H2,27,28,29)/t18-,21-,22-,25-/m1/s1 |
| InChIKey | PRADZNVOAKWXJS-PXOHRUDZSA-N |
| XLogP | 1.01 |
| TPSA | 178.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.55 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |