C15H25N — CID 71001493
(3S)-3-benzyl-4,4-dimethylhexan-1-amine (PubChem CID 71001493) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is (3S)-3-benzyl-4,4-dimethylhexan-1-amine.
| Compound Name | (3S)-3-benzyl-4,4-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 71001493 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | (3S)-3-benzyl-4,4-dimethylhexan-1-amine |
| SMILES | CCC(C)(C)[C@H](CCN)Cc1ccccc1 |
| InChI | InChI=1S/C15H25N/c1-4-15(2,3)14(10-11-16)12-13-8-6-5-7-9-13/h5-9,14H,4,10-12,16H2,1-3H3/t14-/m1/s1 |
| InChIKey | UXLSICWYEZCYGK-CQSZACIVSA-N |
| XLogP | 3.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |