About (2-ethyl-3,3-difluoropentyl)benzene;propane
(2-ethyl-3,3-difluoropentyl)benzene;propane (PubChem CID 171834491) has the molecular formula C16H26F2
and a molecular weight of 256.38 g/mol. Its IUPAC name is (2-ethyl-3,3-difluoropentyl)benzene;propane.
Molecular Properties
| Compound Name | (2-ethyl-3,3-difluoropentyl)benzene;propane |
| PubChem CID | 171834491 |
| Molecular Formula | C16H26F2 |
| Molecular Weight | 256.38 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | (2-ethyl-3,3-difluoropentyl)benzene;propane |
| SMILES | CCC.CCC(Cc1ccccc1)C(F)(F)CC |
| InChI | InChI=1S/C13H18F2.C3H8/c1-3-12(13(14,15)4-2)10-11-8-6-5-7-9-11;1-3-2/h5-9,12H,3-4,10H2,1-2H3;3H2,1-2H3 |
| InChIKey | HYTSFOLEDUVBDI-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.38 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (2-ethyl-3,3-difluoropentyl)benzene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-3,3-difluoropentyl)benzene;propane?
The IUPAC name of (2-ethyl-3,3-difluoropentyl)benzene;propane (CID 171834491) is (2-ethyl-3,3-difluoropentyl)benzene;propane.
What is the SMILES notation for (2-ethyl-3,3-difluoropentyl)benzene;propane?
The canonical SMILES for (2-ethyl-3,3-difluoropentyl)benzene;propane is CCC.CCC(Cc1ccccc1)C(F)(F)CC.
What is the InChIKey of (2-ethyl-3,3-difluoropentyl)benzene;propane?
The InChIKey is HYTSFOLEDUVBDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F2.C3H8/c1-3-12(13(14,15)4-2)10-11-8-6-5-7-9-11;1-3-2/h5-9,12H,3-4,10H2,1-2H3;3H2,1-2H3.
What are the key properties of (2-ethyl-3,3-difluoropentyl)benzene;propane?
(2-ethyl-3,3-difluoropentyl)benzene;propane has a molecular weight of 256.38 g/mol, XLogP of 5.72, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-3,3-difluoropentyl)benzene;propane is sourced from PubChem (CID 171834491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).