C16H26F2 — CID 171834491
(2-ethyl-3,3-difluoropentyl)benzene;propane (PubChem CID 171834491) has the molecular formula C16H26F2 and a molecular weight of 256.38 g/mol. Its IUPAC name is (2-ethyl-3,3-difluoropentyl)benzene;propane.
| Compound Name | (2-ethyl-3,3-difluoropentyl)benzene;propane |
|---|---|
| PubChem CID | 171834491 |
| Molecular Formula | C16H26F2 |
| Molecular Weight | 256.38 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | (2-ethyl-3,3-difluoropentyl)benzene;propane |
| SMILES | CCC.CCC(Cc1ccccc1)C(F)(F)CC |
| InChI | InChI=1S/C13H18F2.C3H8/c1-3-12(13(14,15)4-2)10-11-8-6-5-7-9-11;1-3-2/h5-9,12H,3-4,10H2,1-2H3;3H2,1-2H3 |
| InChIKey | HYTSFOLEDUVBDI-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.38 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |