C15H15FN2O4S — CID 7100589
methyl (3R,8aS)-7-[(4-fluorophenyl)methyl]-5,8-dioxo-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazine-3-carboxylate (PubChem CID 7100589) has the molecular formula C15H15FN2O4S and a molecular weight of 338.36 g/mol. Its IUPAC name is methyl (3R,8aS)-7-[(4-fluorophenyl)methyl]-5,8-dioxo-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazine-3-carboxylate.
| Compound Name | methyl (3R,8aS)-7-[(4-fluorophenyl)methyl]-5,8-dioxo-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazine-3-carboxylate |
|---|---|
| PubChem CID | 7100589 |
| Molecular Formula | C15H15FN2O4S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | methyl (3R,8aS)-7-[(4-fluorophenyl)methyl]-5,8-dioxo-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazine-3-carboxylate |
| SMILES | COC(=O)[C@H]1SC[C@@H]2C(=O)N(Cc3ccc(F)cc3)CC(=O)N21 |
| InChI | InChI=1S/C15H15FN2O4S/c1-22-15(21)14-18-11(8-23-14)13(20)17(7-12(18)19)6-9-2-4-10(16)5-3-9/h2-5,11,14H,6-8H2,1H3/t11-,14-/m1/s1 |
| InChIKey | UUVYSRUTOWFSNO-BXUZGUMPSA-N |
| XLogP | 0.61 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |