C23H23ClF3N3 — CID 71007949
15-chloro-11-[2-[4-(trifluoromethyl)phenyl]ethyl]-7,11,13-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12(17),13,15-tetraene (PubChem CID 71007949) has the molecular formula C23H23ClF3N3 and a molecular weight of 433.91 g/mol. Its IUPAC name is 15-chloro-11-[2-[4-(trifluoromethyl)phenyl]ethyl]-7,11,13-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12(17),13,15-tetraene.
| Compound Name | 15-chloro-11-[2-[4-(trifluoromethyl)phenyl]ethyl]-7,11,13-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12(17),13,15-tetraene |
|---|---|
| PubChem CID | 71007949 |
| Molecular Formula | C23H23ClF3N3 |
| Molecular Weight | 433.91 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 15-chloro-11-[2-[4-(trifluoromethyl)phenyl]ethyl]-7,11,13-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),12(17),13,15-tetraene |
| SMILES | FC(F)(F)c1ccc(CCn2c3c(c4cc(Cl)cnc42)C2CCCCN2CC3)cc1 |
| InChI | InChI=1S/C23H23ClF3N3/c24-17-13-18-21-19-3-1-2-10-29(19)11-9-20(21)30(22(18)28-14-17)12-8-15-4-6-16(7-5-15)23(25,26)27/h4-7,13-14,19H,1-3,8-12H2 |
| InChIKey | MZQHZSSAQJFFSN-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.91 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |