C26H27ClFN5 — CID 71009928
N-[(6-chloro-2-ethylimidazo[1,2-a]pyridin-3-yl)methyl]-4-[4-(4-fluorophenyl)piperazin-1-yl]aniline (PubChem CID 71009928) has the molecular formula C26H27ClFN5 and a molecular weight of 463.99 g/mol. Its IUPAC name is N-[(6-chloro-2-ethylimidazo[1,2-a]pyridin-3-yl)methyl]-4-[4-(4-fluorophenyl)piperazin-1-yl]aniline.
| Compound Name | N-[(6-chloro-2-ethylimidazo[1,2-a]pyridin-3-yl)methyl]-4-[4-(4-fluorophenyl)piperazin-1-yl]aniline |
|---|---|
| PubChem CID | 71009928 |
| Molecular Formula | C26H27ClFN5 |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | N-[(6-chloro-2-ethylimidazo[1,2-a]pyridin-3-yl)methyl]-4-[4-(4-fluorophenyl)piperazin-1-yl]aniline |
| SMILES | CCc1nc2ccc(Cl)cn2c1CNc1ccc(N2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H27ClFN5/c1-2-24-25(33-18-19(27)3-12-26(33)30-24)17-29-21-6-10-23(11-7-21)32-15-13-31(14-16-32)22-8-4-20(28)5-9-22/h3-12,18,29H,2,13-17H2,1H3 |
| InChIKey | AJPLKSKAZURNID-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 35.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|