C26H26FNO2S — CID 71010504
(1R,3aR,4aR,8aR,9S,9aS)-9-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-1-methyl-1,3a,4,4a,5,7,8,8a,9,9a-decahydronaphtho[2,3-c]thiophene-3,6-dione (PubChem CID 71010504) has the molecular formula C26H26FNO2S and a molecular weight of 435.56 g/mol. Its IUPAC name is (1R,3aR,4aR,8aR,9S,9aS)-9-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-1-methyl-1,3a,4,4a,5,7,8,8a,9,9a-decahydronaphtho[2,3-c]thiophene-3,6-dione.
| Compound Name | (1R,3aR,4aR,8aR,9S,9aS)-9-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-1-methyl-1,3a,4,4a,5,7,8,8a,9,9a-decahydronaphtho[2,3-c]thiophene-3,6-dione |
|---|---|
| PubChem CID | 71010504 |
| Molecular Formula | C26H26FNO2S |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | (1R,3aR,4aR,8aR,9S,9aS)-9-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-1-methyl-1,3a,4,4a,5,7,8,8a,9,9a-decahydronaphtho[2,3-c]thiophene-3,6-dione |
| SMILES | C[C@H]1SC(=O)[C@@H]2C[C@@H]3CC(=O)CC[C@H]3[C@H](/C=C/c3ccc(-c4cccc(F)c4)cn3)[C@H]12 |
| InChI | InChI=1S/C26H26FNO2S/c1-15-25-23(22-10-8-21(29)12-18(22)13-24(25)26(30)31-15)9-7-20-6-5-17(14-28-20)16-3-2-4-19(27)11-16/h2-7,9,11,14-15,18,22-25H,8,10,12-13H2,1H3/b9-7+/t15-,18+,22-,23+,24-,25+/m1/s1 |
| InChIKey | LMMLZHIXAXYIND-XOEPROTISA-N |
| XLogP | 5.80 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|