C22H25N3O3S2 — CID 71011048
2-[3-(1,3-benzothiazol-2-yloxy)phenyl]-N-[(3-methylsulfonyl-3-azabicyclo[3.1.0]hexan-2-yl)methyl]ethanamine (PubChem CID 71011048) has the molecular formula C22H25N3O3S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 2-[3-(1,3-benzothiazol-2-yloxy)phenyl]-N-[(3-methylsulfonyl-3-azabicyclo[3.1.0]hexan-2-yl)methyl]ethanamine.
| Compound Name | 2-[3-(1,3-benzothiazol-2-yloxy)phenyl]-N-[(3-methylsulfonyl-3-azabicyclo[3.1.0]hexan-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 71011048 |
| Molecular Formula | C22H25N3O3S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-[3-(1,3-benzothiazol-2-yloxy)phenyl]-N-[(3-methylsulfonyl-3-azabicyclo[3.1.0]hexan-2-yl)methyl]ethanamine |
| SMILES | CS(=O)(=O)N1CC2CC2C1CNCCc1cccc(Oc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C22H25N3O3S2/c1-30(26,27)25-14-16-12-18(16)20(25)13-23-10-9-15-5-4-6-17(11-15)28-22-24-19-7-2-3-8-21(19)29-22/h2-8,11,16,18,20,23H,9-10,12-14H2,1H3 |
| InChIKey | TWFMMXFAFZRGJW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|