C29H32FN4O3+ — CID 71011681
[1-(dimethylamino)-3-[1-[3-[(4-fluorophenyl)methyl]-9-hydroxy-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]cyclopropyl]-3-oxopropylidene]-dimethylazanium (PubChem CID 71011681) has the molecular formula C29H32FN4O3+ and a molecular weight of 503.60 g/mol. Its IUPAC name is [1-(dimethylamino)-3-[1-[3-[(4-fluorophenyl)methyl]-9-hydroxy-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]cyclopropyl]-3-oxopropylidene]-dimethylazanium.
| Compound Name | [1-(dimethylamino)-3-[1-[3-[(4-fluorophenyl)methyl]-9-hydroxy-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]cyclopropyl]-3-oxopropylidene]-dimethylazanium |
|---|---|
| PubChem CID | 71011681 |
| Molecular Formula | C29H32FN4O3+ |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | [1-(dimethylamino)-3-[1-[3-[(4-fluorophenyl)methyl]-9-hydroxy-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]cyclopropyl]-3-oxopropylidene]-dimethylazanium |
| SMILES | CN(C)C(CC(=O)C1(c2c3c(c(O)c4ncc(Cc5ccc(F)cc5)cc24)C(=O)N(C)C3)CC1)=[N+](C)C |
| InChI | InChI=1S/C29H31FN4O3/c1-32(2)23(33(3)4)14-22(35)29(10-11-29)25-20-13-18(12-17-6-8-19(30)9-7-17)15-31-26(20)27(36)24-21(25)16-34(5)28(24)37/h6-9,13,15H,10-12,14,16H2,1-5H3/p+1 |
| InChIKey | LYVJRJSHZKERQZ-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 76.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|