C25H25FN4O2 — CID 143809709
N'-ethenyl-N-ethyl-N-[[3-[(4-fluorophenyl)methyl]-9-hydroxy-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]methyl]methanimidamide (PubChem CID 143809709) has the molecular formula C25H25FN4O2 and a molecular weight of 432.50 g/mol. Its IUPAC name is N'-ethenyl-N-ethyl-N-[[3-[(4-fluorophenyl)methyl]-9-hydroxy-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]methyl]methanimidamide.
| Compound Name | N'-ethenyl-N-ethyl-N-[[3-[(4-fluorophenyl)methyl]-9-hydroxy-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]methyl]methanimidamide |
|---|---|
| PubChem CID | 143809709 |
| Molecular Formula | C25H25FN4O2 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | N'-ethenyl-N-ethyl-N-[[3-[(4-fluorophenyl)methyl]-9-hydroxy-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]methyl]methanimidamide |
| SMILES | C=C/N=C/N(CC)Cc1c2c(c(O)c3ncc(Cc4ccc(F)cc4)cc13)C(=O)N(C)C2 |
| InChI | InChI=1S/C25H25FN4O2/c1-4-27-15-30(5-2)14-20-19-11-17(10-16-6-8-18(26)9-7-16)12-28-23(19)24(31)22-21(20)13-29(3)25(22)32/h4,6-9,11-12,15,31H,1,5,10,13-14H2,2-3H3/b27-15+ |
| InChIKey | YVVPFQLOPPVILB-JFLMPSFJSA-N |
| XLogP | 4.25 |
| TPSA | 69.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|