About ethane;2-[3-[(4-fluorophenyl)methyl]-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]acetic acid
ethane;2-[3-[(4-fluorophenyl)methyl]-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]acetic acid (PubChem CID 143809704) has the molecular formula C23H23FN2O3
and a molecular weight of 394.45 g/mol. Its IUPAC name is ethane;2-[3-[(4-fluorophenyl)methyl]-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]acetic acid.
Molecular Properties
| Compound Name | ethane;2-[3-[(4-fluorophenyl)methyl]-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]acetic acid |
| PubChem CID | 143809704 |
| Molecular Formula | C23H23FN2O3 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | ethane;2-[3-[(4-fluorophenyl)methyl]-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]acetic acid |
| SMILES | CC.CN1Cc2c(cc3ncc(Cc4ccc(F)cc4)cc3c2CC(=O)O)C1=O |
| InChI | InChI=1S/C21H17FN2O3.C2H6/c1-24-11-18-15(9-20(25)26)16-7-13(6-12-2-4-14(22)5-3-12)10-23-19(16)8-17(18)21(24)27;1-2/h2-5,7-8,10H,6,9,11H2,1H3,(H,25,26);1-2H3 |
| InChIKey | RPWRZGRWEGRZBK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-[3-[(4-fluorophenyl)methyl]-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-[3-[(4-fluorophenyl)methyl]-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]acetic acid?
The IUPAC name of ethane;2-[3-[(4-fluorophenyl)methyl]-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]acetic acid (CID 143809704) is ethane;2-[3-[(4-fluorophenyl)methyl]-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]acetic acid.
What is the SMILES notation for ethane;2-[3-[(4-fluorophenyl)methyl]-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]acetic acid?
The canonical SMILES for ethane;2-[3-[(4-fluorophenyl)methyl]-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]acetic acid is CC.CN1Cc2c(cc3ncc(Cc4ccc(F)cc4)cc3c2CC(=O)O)C1=O.
What is the InChIKey of ethane;2-[3-[(4-fluorophenyl)methyl]-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]acetic acid?
The InChIKey is RPWRZGRWEGRZBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17FN2O3.C2H6/c1-24-11-18-15(9-20(25)26)16-7-13(6-12-2-4-14(22)5-3-12)10-23-19(16)8-17(18)21(24)27;1-2/h2-5,7-8,10H,6,9,11H2,1H3,(H,25,26);1-2H3.
What are the key properties of ethane;2-[3-[(4-fluorophenyl)methyl]-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]acetic acid?
ethane;2-[3-[(4-fluorophenyl)methyl]-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]acetic acid has a molecular weight of 394.45 g/mol, XLogP of 4.20, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[3-[(4-fluorophenyl)methyl]-7-methyl-8-oxo-6H-pyrrolo[3,4-g]quinolin-5-yl]acetic acid is sourced from PubChem (CID 143809704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).