C18H15N5O2 — CID 71014265
(E)-2-cyano-N,N-dimethyl-3-[4-(5H-pyrrolo[2,3-b]pyrazin-2-yloxy)phenyl]prop-2-enamide (PubChem CID 71014265) has the molecular formula C18H15N5O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is (E)-2-cyano-N,N-dimethyl-3-[4-(5H-pyrrolo[2,3-b]pyrazin-2-yloxy)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N,N-dimethyl-3-[4-(5H-pyrrolo[2,3-b]pyrazin-2-yloxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 71014265 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (E)-2-cyano-N,N-dimethyl-3-[4-(5H-pyrrolo[2,3-b]pyrazin-2-yloxy)phenyl]prop-2-enamide |
| SMILES | CN(C)C(=O)/C(C#N)=C/c1ccc(Oc2cnc3[nH]ccc3n2)cc1 |
| InChI | InChI=1S/C18H15N5O2/c1-23(2)18(24)13(10-19)9-12-3-5-14(6-4-12)25-16-11-21-17-15(22-16)7-8-20-17/h3-9,11H,1-2H3,(H,20,21)/b13-9+ |
| InChIKey | MQIPKMCXOXLLSA-UKTHLTGXSA-N |
| XLogP | 2.75 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|