C16H15BrN5O4S+ — CID 71014716
(6-bromoimidazo[1,2-a]pyridin-3-yl)-ethylidene-[(2-methyl-5-nitrophenyl)sulfonylamino]azanium (PubChem CID 71014716) has the molecular formula C16H15BrN5O4S+ and a molecular weight of 453.30 g/mol. Its IUPAC name is (6-bromoimidazo[1,2-a]pyridin-3-yl)-ethylidene-[(2-methyl-5-nitrophenyl)sulfonylamino]azanium.
| Compound Name | (6-bromoimidazo[1,2-a]pyridin-3-yl)-ethylidene-[(2-methyl-5-nitrophenyl)sulfonylamino]azanium |
|---|---|
| PubChem CID | 71014716 |
| Molecular Formula | C16H15BrN5O4S+ |
| Molecular Weight | 453.30 g/mol |
| Exact Mass | 452.00 |
| IUPAC Name | (6-bromoimidazo[1,2-a]pyridin-3-yl)-ethylidene-[(2-methyl-5-nitrophenyl)sulfonylamino]azanium |
| SMILES | CC=[N+](NS(=O)(=O)c1cc([N+](=O)[O-])ccc1C)c1cnc2ccc(Br)cn12 |
| InChI | InChI=1S/C16H15BrN5O4S/c1-3-21(16-9-18-15-7-5-12(17)10-20(15)16)19-27(25,26)14-8-13(22(23)24)6-4-11(14)2/h3-10,19H,1-2H3/q+1 |
| InChIKey | NIRSDIJTMYUZBQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|