C17H16BrN5O4S — CID 25023750
N-[(E)-1-(6-bromoimidazo[1,2-a]pyridin-3-yl)ethylideneamino]-N,2-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 25023750) has the molecular formula C17H16BrN5O4S and a molecular weight of 466.32 g/mol. Its IUPAC name is N-[(E)-1-(6-bromoimidazo[1,2-a]pyridin-3-yl)ethylideneamino]-N,2-dimethyl-5-nitrobenzenesulfonamide.
| Compound Name | N-[(E)-1-(6-bromoimidazo[1,2-a]pyridin-3-yl)ethylideneamino]-N,2-dimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 25023750 |
| Molecular Formula | C17H16BrN5O4S |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 465.01 |
| IUPAC Name | N-[(E)-1-(6-bromoimidazo[1,2-a]pyridin-3-yl)ethylideneamino]-N,2-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | C/C(=N\N(C)S(=O)(=O)c1cc([N+](=O)[O-])ccc1C)c1cnc2ccc(Br)cn12 |
| InChI | InChI=1S/C17H16BrN5O4S/c1-11-4-6-14(23(24)25)8-16(11)28(26,27)21(3)20-12(2)15-9-19-17-7-5-13(18)10-22(15)17/h4-10H,1-3H3/b20-12+ |
| InChIKey | KKRZFLKUUIPLCW-UDWIEESQSA-N |
| XLogP | 3.36 |
| TPSA | 110.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|