C20H20N6O4S — CID 57390137
N-[(E)-1-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)butylideneamino]-N,2-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 57390137) has the molecular formula C20H20N6O4S and a molecular weight of 440.49 g/mol. Its IUPAC name is N-[(E)-1-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)butylideneamino]-N,2-dimethyl-5-nitrobenzenesulfonamide.
| Compound Name | N-[(E)-1-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)butylideneamino]-N,2-dimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 57390137 |
| Molecular Formula | C20H20N6O4S |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-[(E)-1-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)butylideneamino]-N,2-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | CCC/C(=N\N(C)S(=O)(=O)c1cc([N+](=O)[O-])ccc1C)c1cnn2ccc(C#N)cc12 |
| InChI | InChI=1S/C20H20N6O4S/c1-4-5-18(17-13-22-25-9-8-15(12-21)10-19(17)25)23-24(3)31(29,30)20-11-16(26(27)28)7-6-14(20)2/h6-11,13H,4-5H2,1-3H3/b23-18+ |
| InChIKey | MYNIKCFXODKJJS-PTGBLXJZSA-N |
| XLogP | 3.25 |
| TPSA | 133.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|