C19H17N5O4S — CID 68502208
methyl 3-[[(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-methylsulfamoyl]-4-methylbenzoate (PubChem CID 68502208) has the molecular formula C19H17N5O4S and a molecular weight of 411.44 g/mol. Its IUPAC name is methyl 3-[[(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-methylsulfamoyl]-4-methylbenzoate.
| Compound Name | methyl 3-[[(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-methylsulfamoyl]-4-methylbenzoate |
|---|---|
| PubChem CID | 68502208 |
| Molecular Formula | C19H17N5O4S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | methyl 3-[[(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-methylsulfamoyl]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(S(=O)(=O)N(C)N=Cc2cnn3ccc(C#N)cc23)c1 |
| InChI | InChI=1S/C19H17N5O4S/c1-13-4-5-15(19(25)28-3)9-18(13)29(26,27)23(2)21-11-16-12-22-24-7-6-14(10-20)8-17(16)24/h4-9,11-12H,1-3H3 |
| InChIKey | RAAQVMOATCKKGG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 117.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|