C17H12N6O2S — CID 25172064
3-cyano-N-[(E)-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-N-methylbenzenesulfonamide (PubChem CID 25172064) has the molecular formula C17H12N6O2S and a molecular weight of 364.39 g/mol. Its IUPAC name is 3-cyano-N-[(E)-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-N-methylbenzenesulfonamide.
| Compound Name | 3-cyano-N-[(E)-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 25172064 |
| Molecular Formula | C17H12N6O2S |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 3-cyano-N-[(E)-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-N-methylbenzenesulfonamide |
| SMILES | CN(/N=C/c1cnn2ccc(C#N)cc12)S(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C17H12N6O2S/c1-22(26(24,25)16-4-2-3-13(7-16)9-18)20-11-15-12-21-23-6-5-14(10-19)8-17(15)23/h2-8,11-12H,1H3/b20-11+ |
| InChIKey | OSINUZDYVPXZFV-RGVLZGJSSA-N |
| XLogP | 1.73 |
| TPSA | 114.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|