C17H11FN6O2S — CID 68500942
5-cyano-N-[(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-2-fluoro-N-methylbenzenesulfonamide (PubChem CID 68500942) has the molecular formula C17H11FN6O2S and a molecular weight of 382.38 g/mol. Its IUPAC name is 5-cyano-N-[(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-2-fluoro-N-methylbenzenesulfonamide.
| Compound Name | 5-cyano-N-[(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-2-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 68500942 |
| Molecular Formula | C17H11FN6O2S |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 5-cyano-N-[(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-2-fluoro-N-methylbenzenesulfonamide |
| SMILES | CN(N=Cc1cnn2ccc(C#N)cc12)S(=O)(=O)c1cc(C#N)ccc1F |
| InChI | InChI=1S/C17H11FN6O2S/c1-23(27(25,26)17-7-12(8-19)2-3-15(17)18)21-10-14-11-22-24-5-4-13(9-20)6-16(14)24/h2-7,10-11H,1H3 |
| InChIKey | COYGZYXTBVAKQC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 114.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|