C19H20N8O4S — CID 134130336
2-[2-aminoethyl(methyl)amino]-N-[(E)-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-N-methyl-5-nitrobenzenesulfonamide (PubChem CID 134130336) has the molecular formula C19H20N8O4S and a molecular weight of 456.49 g/mol. Its IUPAC name is 2-[2-aminoethyl(methyl)amino]-N-[(E)-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-N-methyl-5-nitrobenzenesulfonamide.
| Compound Name | 2-[2-aminoethyl(methyl)amino]-N-[(E)-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-N-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 134130336 |
| Molecular Formula | C19H20N8O4S |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 2-[2-aminoethyl(methyl)amino]-N-[(E)-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-N-methyl-5-nitrobenzenesulfonamide |
| SMILES | CN(CCN)c1ccc([N+](=O)[O-])cc1S(=O)(=O)N(C)/N=C/c1cnn2ccc(C#N)cc12 |
| InChI | InChI=1S/C19H20N8O4S/c1-24(8-6-20)17-4-3-16(27(28)29)10-19(17)32(30,31)25(2)22-12-15-13-23-26-7-5-14(11-21)9-18(15)26/h3-5,7,9-10,12-13H,6,8,20H2,1-2H3/b22-12+ |
| InChIKey | QPTBMDPOZNSWEZ-WSDLNYQXSA-N |
| XLogP | 1.16 |
| TPSA | 163.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|