C21H20N6O4S — CID 142454371
N,2-dimethyl-N-[(E)-[6-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]imidazo[1,2-a]pyridin-3-yl]methylideneamino]-5-nitrobenzenesulfonamide (PubChem CID 142454371) has the molecular formula C21H20N6O4S and a molecular weight of 452.50 g/mol. Its IUPAC name is N,2-dimethyl-N-[(E)-[6-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]imidazo[1,2-a]pyridin-3-yl]methylideneamino]-5-nitrobenzenesulfonamide.
| Compound Name | N,2-dimethyl-N-[(E)-[6-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]imidazo[1,2-a]pyridin-3-yl]methylideneamino]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 142454371 |
| Molecular Formula | C21H20N6O4S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | N,2-dimethyl-N-[(E)-[6-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]imidazo[1,2-a]pyridin-3-yl]methylideneamino]-5-nitrobenzenesulfonamide |
| SMILES | C=C/C(=C\N=C)c1ccc2ncc(/C=N/N(C)S(=O)(=O)c3cc([N+](=O)[O-])ccc3C)n2c1 |
| InChI | InChI=1S/C21H20N6O4S/c1-5-16(11-22-3)17-7-9-21-23-12-19(26(21)14-17)13-24-25(4)32(30,31)20-10-18(27(28)29)8-6-15(20)2/h5-14H,1,3H2,2,4H3/b16-11+,24-13+ |
| InChIKey | NOZXGNWQZMORGD-GKNBENSOSA-N |
| XLogP | 3.43 |
| TPSA | 122.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|