C24H20FN5O2S — CID 71014807
(Z)-2-cyano-3-cyclopropyl-N-[3-[(5-fluoro-4-phenylsulfanylpyrimidin-2-yl)amino]-4-methoxyphenyl]prop-2-enamide (PubChem CID 71014807) has the molecular formula C24H20FN5O2S and a molecular weight of 461.52 g/mol. Its IUPAC name is (Z)-2-cyano-3-cyclopropyl-N-[3-[(5-fluoro-4-phenylsulfanylpyrimidin-2-yl)amino]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-cyclopropyl-N-[3-[(5-fluoro-4-phenylsulfanylpyrimidin-2-yl)amino]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 71014807 |
| Molecular Formula | C24H20FN5O2S |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | (Z)-2-cyano-3-cyclopropyl-N-[3-[(5-fluoro-4-phenylsulfanylpyrimidin-2-yl)amino]-4-methoxyphenyl]prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C\C2CC2)cc1Nc1ncc(F)c(Sc2ccccc2)n1 |
| InChI | InChI=1S/C24H20FN5O2S/c1-32-21-10-9-17(28-22(31)16(13-26)11-15-7-8-15)12-20(21)29-24-27-14-19(25)23(30-24)33-18-5-3-2-4-6-18/h2-6,9-12,14-15H,7-8H2,1H3,(H,28,31)(H,27,29,30)/b16-11- |
| InChIKey | LBVJNYSFMLAIJB-WJDWOHSUSA-N |
| XLogP | 5.32 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|