C18H24N2O5 — CID 7102132
2-[(3S,5R)-5-hexyl-2-oxooxolan-3-yl]-N-(4-nitrophenyl)acetamide (PubChem CID 7102132) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-[(3S,5R)-5-hexyl-2-oxooxolan-3-yl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[(3S,5R)-5-hexyl-2-oxooxolan-3-yl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 7102132 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-[(3S,5R)-5-hexyl-2-oxooxolan-3-yl]-N-(4-nitrophenyl)acetamide |
| SMILES | CCCCCC[C@@H]1C[C@@H](CC(=O)Nc2ccc([N+](=O)[O-])cc2)C(=O)O1 |
| InChI | InChI=1S/C18H24N2O5/c1-2-3-4-5-6-16-11-13(18(22)25-16)12-17(21)19-14-7-9-15(10-8-14)20(23)24/h7-10,13,16H,2-6,11-12H2,1H3,(H,19,21)/t13-,16+/m0/s1 |
| InChIKey | DHFWVGQJAFQZFG-XJKSGUPXSA-N |
| XLogP | 3.83 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|