C19H26N2O5 — CID 7374254
3-[(3S,5S)-5-hexyl-2-oxooxolan-3-yl]-N-(4-nitrophenyl)propanamide (PubChem CID 7374254) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-[(3S,5S)-5-hexyl-2-oxooxolan-3-yl]-N-(4-nitrophenyl)propanamide.
| Compound Name | 3-[(3S,5S)-5-hexyl-2-oxooxolan-3-yl]-N-(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 7374254 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 3-[(3S,5S)-5-hexyl-2-oxooxolan-3-yl]-N-(4-nitrophenyl)propanamide |
| SMILES | CCCCCC[C@H]1C[C@H](CCC(=O)Nc2ccc([N+](=O)[O-])cc2)C(=O)O1 |
| InChI | InChI=1S/C19H26N2O5/c1-2-3-4-5-6-17-13-14(19(23)26-17)7-12-18(22)20-15-8-10-16(11-9-15)21(24)25/h8-11,14,17H,2-7,12-13H2,1H3,(H,20,22)/t14-,17-/m0/s1 |
| InChIKey | GNYOSEKMPAJYLZ-YOEHRIQHSA-N |
| XLogP | 4.22 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|