C17H21N3O6S — CID 7300051
N-[(4-nitrophenyl)carbamothioyl]-2-[(3R,5R)-2-oxo-5-(propan-2-yloxymethyl)oxolan-3-yl]acetamide (PubChem CID 7300051) has the molecular formula C17H21N3O6S and a molecular weight of 395.44 g/mol. Its IUPAC name is N-[(4-nitrophenyl)carbamothioyl]-2-[(3R,5R)-2-oxo-5-(propan-2-yloxymethyl)oxolan-3-yl]acetamide.
| Compound Name | N-[(4-nitrophenyl)carbamothioyl]-2-[(3R,5R)-2-oxo-5-(propan-2-yloxymethyl)oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 7300051 |
| Molecular Formula | C17H21N3O6S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-[(4-nitrophenyl)carbamothioyl]-2-[(3R,5R)-2-oxo-5-(propan-2-yloxymethyl)oxolan-3-yl]acetamide |
| SMILES | CC(C)OC[C@H]1C[C@H](CC(=O)NC(=S)Nc2ccc([N+](=O)[O-])cc2)C(=O)O1 |
| InChI | InChI=1S/C17H21N3O6S/c1-10(2)25-9-14-7-11(16(22)26-14)8-15(21)19-17(27)18-12-3-5-13(6-4-12)20(23)24/h3-6,10-11,14H,7-9H2,1-2H3,(H2,18,19,21,27)/t11-,14-/m1/s1 |
| InChIKey | URBXFLYNHRQGGU-BXUZGUMPSA-N |
| XLogP | 2.15 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|