C25H40N4O7S — CID 71021701
tert-butyl N-[(4R,6S,7Z,14S,18R)-18-methyl-4-(methylsulfonylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate (PubChem CID 71021701) has the molecular formula C25H40N4O7S and a molecular weight of 540.68 g/mol. Its IUPAC name is tert-butyl N-[(4R,6S,7Z,14S,18R)-18-methyl-4-(methylsulfonylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate.
| Compound Name | tert-butyl N-[(4R,6S,7Z,14S,18R)-18-methyl-4-(methylsulfonylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
|---|---|
| PubChem CID | 71021701 |
| Molecular Formula | C25H40N4O7S |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | tert-butyl N-[(4R,6S,7Z,14S,18R)-18-methyl-4-(methylsulfonylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
| SMILES | C[C@@H]1CC2C(=O)N[C@]3(C(=O)NS(C)(=O)=O)C[C@H]3/C=C\CCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N2C1 |
| InChI | InChI=1S/C25H40N4O7S/c1-16-13-19-20(30)27-25(22(32)28-37(5,34)35)14-17(25)11-9-7-6-8-10-12-18(21(31)29(19)15-16)26-23(33)36-24(2,3)4/h9,11,16-19H,6-8,10,12-15H2,1-5H3,(H,26,33)(H,27,30)(H,28,32)/b11-9-/t16-,17-,18+,19?,25-/m1/s1 |
| InChIKey | BLRCXCPPHNGESW-QDZDTIGISA-N |
| XLogP | 1.59 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|