C23H21F2N3O5S — CID 71022485
amino 3-[[[2-(2,3-difluoro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]methyl]benzoate (PubChem CID 71022485) has the molecular formula C23H21F2N3O5S and a molecular weight of 489.50 g/mol. Its IUPAC name is amino 3-[[[2-(2,3-difluoro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]methyl]benzoate.
| Compound Name | amino 3-[[[2-(2,3-difluoro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 71022485 |
| Molecular Formula | C23H21F2N3O5S |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | amino 3-[[[2-(2,3-difluoro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]methyl]benzoate |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCc2cccc(C(=O)ON)c2)c2cccc(F)c2F)cc1 |
| InChI | InChI=1S/C23H21F2N3O5S/c1-15-8-10-18(11-9-15)34(31,32)28(20-7-3-6-19(24)22(20)25)14-21(29)27-13-16-4-2-5-17(12-16)23(30)33-26/h2-12H,13-14,26H2,1H3,(H,27,29) |
| InChIKey | HBRXJICFUWWXFD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|