C28H25ClN4O6S — CID 71022526
amino 3-[[[2-(3-chloro-2-methyl-N-(4-pyridin-2-yloxyphenyl)sulfonylanilino)acetyl]amino]methyl]benzoate (PubChem CID 71022526) has the molecular formula C28H25ClN4O6S and a molecular weight of 581.05 g/mol. Its IUPAC name is amino 3-[[[2-(3-chloro-2-methyl-N-(4-pyridin-2-yloxyphenyl)sulfonylanilino)acetyl]amino]methyl]benzoate.
| Compound Name | amino 3-[[[2-(3-chloro-2-methyl-N-(4-pyridin-2-yloxyphenyl)sulfonylanilino)acetyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 71022526 |
| Molecular Formula | C28H25ClN4O6S |
| Molecular Weight | 581.05 g/mol |
| Exact Mass | 580.12 |
| IUPAC Name | amino 3-[[[2-(3-chloro-2-methyl-N-(4-pyridin-2-yloxyphenyl)sulfonylanilino)acetyl]amino]methyl]benzoate |
| SMILES | Cc1c(Cl)cccc1N(CC(=O)NCc1cccc(C(=O)ON)c1)S(=O)(=O)c1ccc(Oc2ccccn2)cc1 |
| InChI | InChI=1S/C28H25ClN4O6S/c1-19-24(29)8-5-9-25(19)33(18-26(34)32-17-20-6-4-7-21(16-20)28(35)39-30)40(36,37)23-13-11-22(12-14-23)38-27-10-2-3-15-31-27/h2-16H,17-18,30H2,1H3,(H,32,34) |
| InChIKey | CGUYEJZHFYRRID-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 140.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.05 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|