C24H26F4N4O3 — CID 71025690
1-[(1R)-1-[4-(2,5-dimethylpyrrolidine-1-carbonyl)phenyl]ethyl]-3-[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]urea (PubChem CID 71025690) has the molecular formula C24H26F4N4O3 and a molecular weight of 494.49 g/mol. Its IUPAC name is 1-[(1R)-1-[4-(2,5-dimethylpyrrolidine-1-carbonyl)phenyl]ethyl]-3-[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]urea.
| Compound Name | 1-[(1R)-1-[4-(2,5-dimethylpyrrolidine-1-carbonyl)phenyl]ethyl]-3-[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]urea |
|---|---|
| PubChem CID | 71025690 |
| Molecular Formula | C24H26F4N4O3 |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 1-[(1R)-1-[4-(2,5-dimethylpyrrolidine-1-carbonyl)phenyl]ethyl]-3-[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]urea |
| SMILES | CC1CCC(C)N1C(=O)c1ccc([C@@H](C)NC(=O)NNC(=O)c2cc(F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C24H26F4N4O3/c1-13-4-5-14(2)32(13)22(34)17-8-6-16(7-9-17)15(3)29-23(35)31-30-21(33)18-10-19(24(26,27)28)12-20(25)11-18/h6-15H,4-5H2,1-3H3,(H,30,33)(H2,29,31,35)/t13?,14?,15-/m1/s1 |
| InChIKey | YWVHJCKAIMXFBZ-YMAMQOFZSA-N |
| XLogP | 4.56 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|