C17H14Cl2N4OS — CID 71027184
2-amino-4-(5-butoxy-2,4-dichlorophenyl)thieno[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 71027184) has the molecular formula C17H14Cl2N4OS and a molecular weight of 393.30 g/mol. Its IUPAC name is 2-amino-4-(5-butoxy-2,4-dichlorophenyl)thieno[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | 2-amino-4-(5-butoxy-2,4-dichlorophenyl)thieno[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 71027184 |
| Molecular Formula | C17H14Cl2N4OS |
| Molecular Weight | 393.30 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 2-amino-4-(5-butoxy-2,4-dichlorophenyl)thieno[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | CCCCOc1cc(-c2nc(N)nc3sc(C#N)cc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H14Cl2N4OS/c1-2-3-4-24-14-6-10(12(18)7-13(14)19)15-11-5-9(8-20)25-16(11)23-17(21)22-15/h5-7H,2-4H2,1H3,(H2,21,22,23) |
| InChIKey | AFLPDOWWEQZCDP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.30 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|