C18H25NO — CID 7102723
(1S,2S,4S)-N-(4-butylphenyl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 7102723) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is (1S,2S,4S)-N-(4-butylphenyl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,4S)-N-(4-butylphenyl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 7102723 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (1S,2S,4S)-N-(4-butylphenyl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CCCCc1ccc(NC(=O)[C@H]2C[C@H]3CC[C@H]2C3)cc1 |
| InChI | InChI=1S/C18H25NO/c1-2-3-4-13-6-9-16(10-7-13)19-18(20)17-12-14-5-8-15(17)11-14/h6-7,9-10,14-15,17H,2-5,8,11-12H2,1H3,(H,19,20)/t14-,15-,17-/m0/s1 |
| InChIKey | PKCXZIIGNLTGJK-ZOBUZTSGSA-N |
| XLogP | 4.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |