C23H28N4 — CID 71029236
2-[[bis(pyridin-2-ylmethyl)amino]methyl]-N-methyl-N-propan-2-ylaniline (PubChem CID 71029236) has the molecular formula C23H28N4 and a molecular weight of 360.50 g/mol. Its IUPAC name is 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-N-methyl-N-propan-2-ylaniline.
| Compound Name | 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-N-methyl-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 71029236 |
| Molecular Formula | C23H28N4 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-N-methyl-N-propan-2-ylaniline |
| SMILES | CC(C)N(C)c1ccccc1CN(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C23H28N4/c1-19(2)26(3)23-13-5-4-10-20(23)16-27(17-21-11-6-8-14-24-21)18-22-12-7-9-15-25-22/h4-15,19H,16-18H2,1-3H3 |
| InChIKey | PJQJGFKLNOGMQV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |