C20H34FN3O4 — CID 71029306
2-[[(2S)-2-cyclopentyl-2-(methylamino)acetyl]amino]-N-(1-fluoro-4,5-dioxohexan-3-yl)-4-methylpentanamide (PubChem CID 71029306) has the molecular formula C20H34FN3O4 and a molecular weight of 399.51 g/mol. Its IUPAC name is 2-[[(2S)-2-cyclopentyl-2-(methylamino)acetyl]amino]-N-(1-fluoro-4,5-dioxohexan-3-yl)-4-methylpentanamide.
| Compound Name | 2-[[(2S)-2-cyclopentyl-2-(methylamino)acetyl]amino]-N-(1-fluoro-4,5-dioxohexan-3-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 71029306 |
| Molecular Formula | C20H34FN3O4 |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | 2-[[(2S)-2-cyclopentyl-2-(methylamino)acetyl]amino]-N-(1-fluoro-4,5-dioxohexan-3-yl)-4-methylpentanamide |
| SMILES | CN[C@H](C(=O)NC(CC(C)C)C(=O)NC(CCF)C(=O)C(C)=O)C1CCCC1 |
| InChI | InChI=1S/C20H34FN3O4/c1-12(2)11-16(19(27)23-15(9-10-21)18(26)13(3)25)24-20(28)17(22-4)14-7-5-6-8-14/h12,14-17,22H,5-11H2,1-4H3,(H,23,27)(H,24,28)/t15?,16?,17-/m0/s1 |
| InChIKey | WHMJZRFLJJMIBC-JCYILVPMSA-N |
| XLogP | 1.30 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|