C19H19NO3 — CID 71032377
6,7-dihydroxy-2-[[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]methyl]-3H-isoindol-1-one (PubChem CID 71032377) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 6,7-dihydroxy-2-[[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]methyl]-3H-isoindol-1-one.
| Compound Name | 6,7-dihydroxy-2-[[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 71032377 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 6,7-dihydroxy-2-[[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]methyl]-3H-isoindol-1-one |
| SMILES | O=C1c2c(ccc(O)c2O)CN1C[C@H]1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H19NO3/c21-16-8-7-15-11-20(19(23)17(15)18(16)22)10-12-5-6-13-3-1-2-4-14(13)9-12/h1-4,7-8,12,21-22H,5-6,9-11H2/t12-/m0/s1 |
| InChIKey | RZTDTFIGPIEQDW-LBPRGKRZSA-N |
| XLogP | 2.86 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|