C20H21BrN4 — CID 71033744
2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4-bromo-N-methylaniline (PubChem CID 71033744) has the molecular formula C20H21BrN4 and a molecular weight of 397.32 g/mol. Its IUPAC name is 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4-bromo-N-methylaniline.
| Compound Name | 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4-bromo-N-methylaniline |
|---|---|
| PubChem CID | 71033744 |
| Molecular Formula | C20H21BrN4 |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4-bromo-N-methylaniline |
| SMILES | CNc1ccc(Br)cc1CN(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C20H21BrN4/c1-22-20-9-8-17(21)12-16(20)13-25(14-18-6-2-4-10-23-18)15-19-7-3-5-11-24-19/h2-12,22H,13-15H2,1H3 |
| InChIKey | KPVNOEXYYJLOHZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |