C22H16F3N3S — CID 71033914
4-(pyridin-4-ylmethyl)-N-[4-(trifluoromethylsulfanyl)phenyl]isoquinolin-1-amine (PubChem CID 71033914) has the molecular formula C22H16F3N3S and a molecular weight of 411.45 g/mol. Its IUPAC name is 4-(pyridin-4-ylmethyl)-N-[4-(trifluoromethylsulfanyl)phenyl]isoquinolin-1-amine.
| Compound Name | 4-(pyridin-4-ylmethyl)-N-[4-(trifluoromethylsulfanyl)phenyl]isoquinolin-1-amine |
|---|---|
| PubChem CID | 71033914 |
| Molecular Formula | C22H16F3N3S |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 4-(pyridin-4-ylmethyl)-N-[4-(trifluoromethylsulfanyl)phenyl]isoquinolin-1-amine |
| SMILES | FC(F)(F)Sc1ccc(Nc2ncc(Cc3ccncc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C22H16F3N3S/c23-22(24,25)29-18-7-5-17(6-8-18)28-21-20-4-2-1-3-19(20)16(14-27-21)13-15-9-11-26-12-10-15/h1-12,14H,13H2,(H,27,28) |
| InChIKey | PMEUKVKJYVXVIJ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |