C20H22N4OS — CID 71035957
N-[(2R,4R)-2-(1H-benzimidazol-2-yl)piperidin-4-yl]-2-methylsulfanylbenzamide (PubChem CID 71035957) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is N-[(2R,4R)-2-(1H-benzimidazol-2-yl)piperidin-4-yl]-2-methylsulfanylbenzamide.
| Compound Name | N-[(2R,4R)-2-(1H-benzimidazol-2-yl)piperidin-4-yl]-2-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 71035957 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-[(2R,4R)-2-(1H-benzimidazol-2-yl)piperidin-4-yl]-2-methylsulfanylbenzamide |
| SMILES | CSc1ccccc1C(=O)N[C@@H]1CCN[C@@H](c2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C20H22N4OS/c1-26-18-9-5-2-6-14(18)20(25)22-13-10-11-21-17(12-13)19-23-15-7-3-4-8-16(15)24-19/h2-9,13,17,21H,10-12H2,1H3,(H,22,25)(H,23,24)/t13-,17-/m1/s1 |
| InChIKey | NRBQOTLRTHSNBI-CXAGYDPISA-N |
| XLogP | 3.51 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |