C18H13BrO — CID 71036330
8-bromo-15-methyltetracyclo[11.4.0.02,4.05,10]heptadeca-1(13),2(4),5(10),6,8,14,16-heptaen-3-one (PubChem CID 71036330) has the molecular formula C18H13BrO and a molecular weight of 325.21 g/mol. Its IUPAC name is 8-bromo-15-methyltetracyclo[11.4.0.02,4.05,10]heptadeca-1(13),2(4),5(10),6,8,14,16-heptaen-3-one.
| Compound Name | 8-bromo-15-methyltetracyclo[11.4.0.02,4.05,10]heptadeca-1(13),2(4),5(10),6,8,14,16-heptaen-3-one |
|---|---|
| PubChem CID | 71036330 |
| Molecular Formula | C18H13BrO |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 8-bromo-15-methyltetracyclo[11.4.0.02,4.05,10]heptadeca-1(13),2(4),5(10),6,8,14,16-heptaen-3-one |
| SMILES | Cc1ccc2c(c1)CCc1cc(Br)ccc1-c1c-2c1=O |
| InChI | InChI=1S/C18H13BrO/c1-10-2-6-14-11(8-10)3-4-12-9-13(19)5-7-15(12)17-16(14)18(17)20/h2,5-9H,3-4H2,1H3 |
| InChIKey | SNQWKWMLEQUJBZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |