C11H11Cl2NO2 — CID 71039183
(6S)-6-(2,5-dichlorophenyl)-3-methyl-1,3-oxazinan-2-one (PubChem CID 71039183) has the molecular formula C11H11Cl2NO2 and a molecular weight of 260.12 g/mol. Its IUPAC name is (6S)-6-(2,5-dichlorophenyl)-3-methyl-1,3-oxazinan-2-one.
| Compound Name | (6S)-6-(2,5-dichlorophenyl)-3-methyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 71039183 |
| Molecular Formula | C11H11Cl2NO2 |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | (6S)-6-(2,5-dichlorophenyl)-3-methyl-1,3-oxazinan-2-one |
| SMILES | CN1CC[C@@H](c2cc(Cl)ccc2Cl)OC1=O |
| InChI | InChI=1S/C11H11Cl2NO2/c1-14-5-4-10(16-11(14)15)8-6-7(12)2-3-9(8)13/h2-3,6,10H,4-5H2,1H3/t10-/m0/s1 |
| InChIKey | BLHXFPQXRCLXHA-JTQLQIEISA-N |
| XLogP | 3.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |