C13H14Cl2FNO2 — CID 66720568
(3,5-dichloro-4-fluorophenyl)methyl piperidine-1-carboxylate (PubChem CID 66720568) has the molecular formula C13H14Cl2FNO2 and a molecular weight of 306.16 g/mol. Its IUPAC name is (3,5-dichloro-4-fluorophenyl)methyl piperidine-1-carboxylate.
| Compound Name | (3,5-dichloro-4-fluorophenyl)methyl piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66720568 |
| Molecular Formula | C13H14Cl2FNO2 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | (3,5-dichloro-4-fluorophenyl)methyl piperidine-1-carboxylate |
| SMILES | O=C(OCc1cc(Cl)c(F)c(Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C13H14Cl2FNO2/c14-10-6-9(7-11(15)12(10)16)8-19-13(18)17-4-2-1-3-5-17/h6-7H,1-5,8H2 |
| InChIKey | XUSSEHJPBXTUDM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|